About 3-hydroxy-N,N,2,4-tetramethylpent-4-enamide
3-hydroxy-N,N,2,4-tetramethylpent-4-enamide (PubChem CID 143478741) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-hydroxy-N,N,2,4-tetramethylpent-4-enamide.
Molecular Properties
| Compound Name | 3-hydroxy-N,N,2,4-tetramethylpent-4-enamide |
| PubChem CID | 143478741 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 3-hydroxy-N,N,2,4-tetramethylpent-4-enamide |
| SMILES | C=C(C)C(O)C(C)C(=O)N(C)C |
| InChI | InChI=1S/C9H17NO2/c1-6(2)8(11)7(3)9(12)10(4)5/h7-8,11H,1H2,2-5H3 |
| InChIKey | IFIXBJCCFOICJU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-N,N,2,4-tetramethylpent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-N,N,2,4-tetramethylpent-4-enamide?
The IUPAC name of 3-hydroxy-N,N,2,4-tetramethylpent-4-enamide (CID 143478741) is 3-hydroxy-N,N,2,4-tetramethylpent-4-enamide.
What is the SMILES notation for 3-hydroxy-N,N,2,4-tetramethylpent-4-enamide?
The canonical SMILES for 3-hydroxy-N,N,2,4-tetramethylpent-4-enamide is C=C(C)C(O)C(C)C(=O)N(C)C.
What is the InChIKey of 3-hydroxy-N,N,2,4-tetramethylpent-4-enamide?
The InChIKey is IFIXBJCCFOICJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-6(2)8(11)7(3)9(12)10(4)5/h7-8,11H,1H2,2-5H3.
What are the key properties of 3-hydroxy-N,N,2,4-tetramethylpent-4-enamide?
3-hydroxy-N,N,2,4-tetramethylpent-4-enamide has a molecular weight of 171.24 g/mol, XLogP of 0.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-N,N,2,4-tetramethylpent-4-enamide is sourced from PubChem (CID 143478741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).