C12H18N2S — CID 143478753
[4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]-2,3-dihydro-1,3-thiazol-2-yl]methanamine (PubChem CID 143478753) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is [4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]-2,3-dihydro-1,3-thiazol-2-yl]methanamine.
| Compound Name | [4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]-2,3-dihydro-1,3-thiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 143478753 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | [4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]-2,3-dihydro-1,3-thiazol-2-yl]methanamine |
| SMILES | C=C/C=C(/CC1=CSC(CN)N1)C(=C)C |
| InChI | InChI=1S/C12H18N2S/c1-4-5-10(9(2)3)6-11-8-15-12(7-13)14-11/h4-5,8,12,14H,1-2,6-7,13H2,3H3/b10-5- |
| InChIKey | WWWAAGIGTCVREA-YHYXMXQVSA-N |
| XLogP | 2.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|