C29H32FN3O4S — CID 143478897
(2R,3R)-N-[(4-benzyl-1,3-thiazol-2-yl)methyl]-4-[(1R)-1-(3-fluorocyclohexyl)-1,3-dihydroisoindol-2-yl]-2,3-dihydroxy-4-oxobutanamide (PubChem CID 143478897) has the molecular formula C29H32FN3O4S and a molecular weight of 537.66 g/mol. Its IUPAC name is (2R,3R)-N-[(4-benzyl-1,3-thiazol-2-yl)methyl]-4-[(1R)-1-(3-fluorocyclohexyl)-1,3-dihydroisoindol-2-yl]-2,3-dihydroxy-4-oxobutanamide.
| Compound Name | (2R,3R)-N-[(4-benzyl-1,3-thiazol-2-yl)methyl]-4-[(1R)-1-(3-fluorocyclohexyl)-1,3-dihydroisoindol-2-yl]-2,3-dihydroxy-4-oxobutanamide |
|---|---|
| PubChem CID | 143478897 |
| Molecular Formula | C29H32FN3O4S |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | (2R,3R)-N-[(4-benzyl-1,3-thiazol-2-yl)methyl]-4-[(1R)-1-(3-fluorocyclohexyl)-1,3-dihydroisoindol-2-yl]-2,3-dihydroxy-4-oxobutanamide |
| SMILES | O=C(NCc1nc(Cc2ccccc2)cs1)[C@H](O)[C@@H](O)C(=O)N1Cc2ccccc2[C@H]1C1CCCC(F)C1 |
| InChI | InChI=1S/C29H32FN3O4S/c30-21-11-6-10-19(14-21)25-23-12-5-4-9-20(23)16-33(25)29(37)27(35)26(34)28(36)31-15-24-32-22(17-38-24)13-18-7-2-1-3-8-18/h1-5,7-9,12,17,19,21,25-27,34-35H,6,10-11,13-16H2,(H,31,36)/t19?,21?,25-,26-,27-/m1/s1 |
| InChIKey | AVLPSKVVHJTMMN-WRSNTVNJSA-N |
| XLogP | 3.68 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |