About ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole
ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole (PubChem CID 143479526) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole.
Molecular Properties
| Compound Name | ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole |
| PubChem CID | 143479526 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole |
| SMILES | CC.CN1CCC2=C1C=CCC=C2 |
| InChI | InChI=1S/C10H13N.C2H6/c1-11-8-7-9-5-3-2-4-6-10(9)11;1-2/h3-6H,2,7-8H2,1H3;1-2H3 |
| InChIKey | OTMVQGPJWFXWSW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole?
The IUPAC name of ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole (CID 143479526) is ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole.
What is the SMILES notation for ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole?
The canonical SMILES for ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole is CC.CN1CCC2=C1C=CCC=C2.
What is the InChIKey of ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole?
The InChIKey is OTMVQGPJWFXWSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.C2H6/c1-11-8-7-9-5-3-2-4-6-10(9)11;1-2/h3-6H,2,7-8H2,1H3;1-2H3.
What are the key properties of ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole?
ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole has a molecular weight of 177.29 g/mol, XLogP of 3.12, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-3,6-dihydro-2H-cyclohepta[b]pyrrole is sourced from PubChem (CID 143479526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).