About 2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol
2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol (PubChem CID 143479577) has the molecular formula C14H12FNOS
and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol.
Molecular Properties
| Compound Name | 2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol |
| PubChem CID | 143479577 |
| Molecular Formula | C14H12FNOS |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol |
| SMILES | Cc1cc(C2Nc3ccc(O)cc3S2)ccc1F |
| InChI | InChI=1S/C14H12FNOS/c1-8-6-9(2-4-11(8)15)14-16-12-5-3-10(17)7-13(12)18-14/h2-7,14,16-17H,1H3 |
| InChIKey | ZTPNAJONAWJXJS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol?
The IUPAC name of 2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol (CID 143479577) is 2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol.
What is the SMILES notation for 2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol?
The canonical SMILES for 2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol is Cc1cc(C2Nc3ccc(O)cc3S2)ccc1F.
What is the InChIKey of 2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol?
The InChIKey is ZTPNAJONAWJXJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FNOS/c1-8-6-9(2-4-11(8)15)14-16-12-5-3-10(17)7-13(12)18-14/h2-7,14,16-17H,1H3.
What are the key properties of 2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol?
2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol has a molecular weight of 261.32 g/mol, XLogP of 4.06, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoro-3-methylphenyl)-2,3-dihydro-1,3-benzothiazol-6-ol is sourced from PubChem (CID 143479577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).