C20H16F3N5O2 — CID 143479679
(Z)-3-[5-(1,3-benzodioxol-5-ylmethyl)-1H-1,2,4-triazol-3-yl]-N'-[3-(trifluoromethyl)phenyl]prop-2-enimidamide (PubChem CID 143479679) has the molecular formula C20H16F3N5O2 and a molecular weight of 415.38 g/mol. Its IUPAC name is (Z)-3-[5-(1,3-benzodioxol-5-ylmethyl)-1H-1,2,4-triazol-3-yl]-N'-[3-(trifluoromethyl)phenyl]prop-2-enimidamide.
| Compound Name | (Z)-3-[5-(1,3-benzodioxol-5-ylmethyl)-1H-1,2,4-triazol-3-yl]-N'-[3-(trifluoromethyl)phenyl]prop-2-enimidamide |
|---|---|
| PubChem CID | 143479679 |
| Molecular Formula | C20H16F3N5O2 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | (Z)-3-[5-(1,3-benzodioxol-5-ylmethyl)-1H-1,2,4-triazol-3-yl]-N'-[3-(trifluoromethyl)phenyl]prop-2-enimidamide |
| SMILES | NC(/C=C\c1n[nH]c(Cc2ccc3c(c2)OCO3)n1)=N\c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F3N5O2/c21-20(22,23)13-2-1-3-14(10-13)25-17(24)6-7-18-26-19(28-27-18)9-12-4-5-15-16(8-12)30-11-29-15/h1-8,10H,9,11H2,(H2,24,25)(H,26,27,28)/b7-6- |
| InChIKey | GDUCBJGJXFZJMU-SREVYHEPSA-N |
| XLogP | 3.85 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|