C20H15Cl2N5O2 — CID 143479753
3-(1,3-benzodioxol-5-ylmethyl)-N-(3,5-dichlorocyclohepta-2,4,6-trien-1-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 143479753) has the molecular formula C20H15Cl2N5O2 and a molecular weight of 428.28 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-N-(3,5-dichlorocyclohepta-2,4,6-trien-1-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-N-(3,5-dichlorocyclohepta-2,4,6-trien-1-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 143479753 |
| Molecular Formula | C20H15Cl2N5O2 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-N-(3,5-dichlorocyclohepta-2,4,6-trien-1-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | ClC1=CC(Cl)=CC(Nc2ccc3nnc(Cc4ccc5c(c4)OCO5)n3n2)C=C1 |
| InChI | InChI=1S/C20H15Cl2N5O2/c21-13-2-3-15(10-14(22)9-13)23-18-5-6-19-24-25-20(27(19)26-18)8-12-1-4-16-17(7-12)29-11-28-16/h1-7,9-10,15H,8,11H2,(H,23,26) |
| InChIKey | MQFNHRYJYMEZSQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |