C19H21N7O2 — CID 143480277
N-[4-[4-amino-7-[(3-oxopiperazin-1-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]cyclohepta-1,3,5-trien-1-yl]formamide (PubChem CID 143480277) has the molecular formula C19H21N7O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[4-[4-amino-7-[(3-oxopiperazin-1-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]cyclohepta-1,3,5-trien-1-yl]formamide.
| Compound Name | N-[4-[4-amino-7-[(3-oxopiperazin-1-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]cyclohepta-1,3,5-trien-1-yl]formamide |
|---|---|
| PubChem CID | 143480277 |
| Molecular Formula | C19H21N7O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-[4-[4-amino-7-[(3-oxopiperazin-1-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]cyclohepta-1,3,5-trien-1-yl]formamide |
| SMILES | Nc1ncnn2c(CN3CCNC(=O)C3)cc(C3=CC=C(NC=O)CC=C3)c12 |
| InChI | InChI=1S/C19H21N7O2/c20-19-18-16(13-2-1-3-14(5-4-13)23-12-27)8-15(26(18)24-11-22-19)9-25-7-6-21-17(28)10-25/h1-2,4-5,8,11-12H,3,6-7,9-10H2,(H,21,28)(H,23,27)(H2,20,22,24) |
| InChIKey | VUMGERGSPGRWCW-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 117.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|