About 2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene
2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene (PubChem CID 143480728) has the molecular formula C22H28ClFN2
and a molecular weight of 374.93 g/mol. Its IUPAC name is 2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene.
Molecular Properties
| Compound Name | 2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene |
| PubChem CID | 143480728 |
| Molecular Formula | C22H28ClFN2 |
| Molecular Weight | 374.93 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene |
| SMILES | CC1CCN(C)C1.CCc1ccccc1F.Cc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C8H6ClN.C8H9F.C6H13N/c1-6-2-3-7(5-10)8(9)4-6;1-2-7-5-3-4-6-8(7)9;1-6-3-4-7(2)5-6/h2-4H,1H3;3-6H,2H2,1H3;6H,3-5H2,1-2H3 |
| InChIKey | VGRRIAFLFJLFSF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.93 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene?
The IUPAC name of 2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene (CID 143480728) is 2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene.
What is the SMILES notation for 2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene?
The canonical SMILES for 2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene is CC1CCN(C)C1.CCc1ccccc1F.Cc1ccc(C#N)c(Cl)c1.
What is the InChIKey of 2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene?
The InChIKey is VGRRIAFLFJLFSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN.C8H9F.C6H13N/c1-6-2-3-7(5-10)8(9)4-6;1-2-7-5-3-4-6-8(7)9;1-6-3-4-7(2)5-6/h2-4H,1H3;3-6H,2H2,1H3;6H,3-5H2,1-2H3.
What are the key properties of 2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene?
2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene has a molecular weight of 374.93 g/mol, XLogP of 5.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methylbenzonitrile;1,3-dimethylpyrrolidine;1-ethyl-2-fluorobenzene is sourced from PubChem (CID 143480728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).