About 6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane
6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane (PubChem CID 143481182) has the molecular formula C8H15N3O2
and a molecular weight of 185.23 g/mol. Its IUPAC name is 6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane.
Molecular Properties
| Compound Name | 6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane |
| PubChem CID | 143481182 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane |
| SMILES | CC.Cn1c(N)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C6H9N3O2.C2H6/c1-8-4(7)3-5(10)9(2)6(8)11;1-2/h3H,7H2,1-2H3;1-2H3 |
| InChIKey | JHTUTBZFQPOPIL-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane?
The IUPAC name of 6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane (CID 143481182) is 6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane.
What is the SMILES notation for 6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane?
The canonical SMILES for 6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane is CC.Cn1c(N)cc(=O)n(C)c1=O.
What is the InChIKey of 6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane?
The InChIKey is JHTUTBZFQPOPIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2.C2H6/c1-8-4(7)3-5(10)9(2)6(8)11;1-2/h3H,7H2,1-2H3;1-2H3.
What are the key properties of 6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane?
6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane has a molecular weight of 185.23 g/mol, XLogP of -0.31, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1,3-dimethylpyrimidine-2,4-dione;ethane is sourced from PubChem (CID 143481182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).