About (3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one
(3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one (PubChem CID 143481482) has the molecular formula C11H8N5OP
and a molecular weight of 257.19 g/mol. Its IUPAC name is (3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one.
Molecular Properties
| Compound Name | (3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one |
| PubChem CID | 143481482 |
| Molecular Formula | C11H8N5OP |
| Molecular Weight | 257.19 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one |
| SMILES | [H]/N=c1\c(=O)c2ccccc2\c1=N\c1nnc(N)[pH]1 |
| InChI | InChI=1S/C11H8N5OP/c12-7-8(14-11-16-15-10(13)18-11)5-3-1-2-4-6(5)9(7)17/h1-4,12,18H,(H2,13,15)/b12-7-,14-8- |
| InChIKey | SPVRDGKMIBPDMS-FFNMSDODSA-N |
| XLogP | 0.19 |
| TPSA | 105.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one?
The IUPAC name of (3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one (CID 143481482) is (3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one.
What is the SMILES notation for (3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one?
The canonical SMILES for (3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one is [H]/N=c1\c(=O)c2ccccc2\c1=N\c1nnc(N)[pH]1.
What is the InChIKey of (3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one?
The InChIKey is SPVRDGKMIBPDMS-FFNMSDODSA-N. The full InChI is InChI=1S/C11H8N5OP/c12-7-8(14-11-16-15-10(13)18-11)5-3-1-2-4-6(5)9(7)17/h1-4,12,18H,(H2,13,15)/b12-7-,14-8-.
What are the key properties of (3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one?
(3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one has a molecular weight of 257.19 g/mol, XLogP of 0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(5-amino-4H-1,2,4-diazaphosphol-3-yl)imino]-2-iminoinden-1-one is sourced from PubChem (CID 143481482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).