C21H39N5 — CID 143481513
N-amino-1-(4-amino-4-phenylbutan-2-yl)-N-propan-2-ylpiperidine-4-carboximidamide;ethane (PubChem CID 143481513) has the molecular formula C21H39N5 and a molecular weight of 361.58 g/mol. Its IUPAC name is N-amino-1-(4-amino-4-phenylbutan-2-yl)-N-propan-2-ylpiperidine-4-carboximidamide;ethane.
| Compound Name | N-amino-1-(4-amino-4-phenylbutan-2-yl)-N-propan-2-ylpiperidine-4-carboximidamide;ethane |
|---|---|
| PubChem CID | 143481513 |
| Molecular Formula | C21H39N5 |
| Molecular Weight | 361.58 g/mol |
| Exact Mass | 361.32 |
| IUPAC Name | N-amino-1-(4-amino-4-phenylbutan-2-yl)-N-propan-2-ylpiperidine-4-carboximidamide;ethane |
| SMILES | CC.[H]/N=C(/C1CCN(C(C)CC(N)c2ccccc2)CC1)N(N)C(C)C |
| InChI | InChI=1S/C19H33N5.C2H6/c1-14(2)24(22)19(21)17-9-11-23(12-10-17)15(3)13-18(20)16-7-5-4-6-8-16;1-2/h4-8,14-15,17-18,21H,9-13,20,22H2,1-3H3;1-2H3/b21-19-; |
| InChIKey | ZHENRPUVICGURX-WQGAEACMSA-N |
| XLogP | 3.76 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|