About [(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate
[(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate (PubChem CID 143481806) has the molecular formula C16H16O3
and a molecular weight of 256.30 g/mol. Its IUPAC name is [(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate.
Molecular Properties
| Compound Name | [(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate |
| PubChem CID | 143481806 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | [(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate |
| SMILES | C=C/C=C(/OC(=O)Cc1ccc(C)cc1)C(=C)C=O |
| InChI | InChI=1S/C16H16O3/c1-4-5-15(13(3)11-17)19-16(18)10-14-8-6-12(2)7-9-14/h4-9,11H,1,3,10H2,2H3/b15-5+ |
| InChIKey | CUFKNENHPXTWDM-PJQLUOCWSA-N |
| XLogP | 2.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate?
The IUPAC name of [(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate (CID 143481806) is [(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate.
What is the SMILES notation for [(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate?
The canonical SMILES for [(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate is C=C/C=C(/OC(=O)Cc1ccc(C)cc1)C(=C)C=O.
What is the InChIKey of [(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate?
The InChIKey is CUFKNENHPXTWDM-PJQLUOCWSA-N. The full InChI is InChI=1S/C16H16O3/c1-4-5-15(13(3)11-17)19-16(18)10-14-8-6-12(2)7-9-14/h4-9,11H,1,3,10H2,2H3/b15-5+.
What are the key properties of [(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate?
[(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate has a molecular weight of 256.30 g/mol, XLogP of 2.91, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-2-formylhexa-1,3,5-trien-3-yl] 2-(4-methylphenyl)acetate is sourced from PubChem (CID 143481806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).