C32H46N4O2S — CID 143482345
ethane;(E)-N-[[4-[(Z)-hex-4-enyl]-3,5-dimethylthiophen-2-yl]methyl]-N-methyl-3-(1'-methyl-7-oxospiro[5,8-dihydro-1,8-naphthyridine-6,4'-piperidine]-3-yl)prop-2-enamide (PubChem CID 143482345) has the molecular formula C32H46N4O2S and a molecular weight of 550.81 g/mol. Its IUPAC name is ethane;(E)-N-[[4-[(Z)-hex-4-enyl]-3,5-dimethylthiophen-2-yl]methyl]-N-methyl-3-(1'-methyl-7-oxospiro[5,8-dihydro-1,8-naphthyridine-6,4'-piperidine]-3-yl)prop-2-enamide.
| Compound Name | ethane;(E)-N-[[4-[(Z)-hex-4-enyl]-3,5-dimethylthiophen-2-yl]methyl]-N-methyl-3-(1'-methyl-7-oxospiro[5,8-dihydro-1,8-naphthyridine-6,4'-piperidine]-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 143482345 |
| Molecular Formula | C32H46N4O2S |
| Molecular Weight | 550.81 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | ethane;(E)-N-[[4-[(Z)-hex-4-enyl]-3,5-dimethylthiophen-2-yl]methyl]-N-methyl-3-(1'-methyl-7-oxospiro[5,8-dihydro-1,8-naphthyridine-6,4'-piperidine]-3-yl)prop-2-enamide |
| SMILES | C/C=C\CCCc1c(C)sc(CN(C)C(=O)/C=C/c2cnc3c(c2)CC2(CCN(C)CC2)C(=O)N3)c1C.CC |
| InChI | InChI=1S/C30H40N4O2S.C2H6/c1-6-7-8-9-10-25-21(2)26(37-22(25)3)20-34(5)27(35)12-11-23-17-24-18-30(13-15-33(4)16-14-30)29(36)32-28(24)31-19-23;1-2/h6-7,11-12,17,19H,8-10,13-16,18,20H2,1-5H3,(H,31,32,36);1-2H3/b7-6-,12-11+; |
| InChIKey | HAQFWLYVBIQAKF-FJHVZPPQSA-N |
| XLogP | 6.56 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.81 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|