About N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine
N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine (PubChem CID 143482378) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine |
| PubChem CID | 143482378 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine |
| SMILES | CNCC1=C(C)C2=CC=CCC2O1 |
| InChI | InChI=1S/C11H15NO/c1-8-9-5-3-4-6-10(9)13-11(8)7-12-2/h3-5,10,12H,6-7H2,1-2H3 |
| InChIKey | XPNOEUNEXQDDAT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine?
The IUPAC name of N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine (CID 143482378) is N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine.
What is the SMILES notation for N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine?
The canonical SMILES for N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine is CNCC1=C(C)C2=CC=CCC2O1.
What is the InChIKey of N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine?
The InChIKey is XPNOEUNEXQDDAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-8-9-5-3-4-6-10(9)13-11(8)7-12-2/h3-5,10,12H,6-7H2,1-2H3.
What are the key properties of N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine?
N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine has a molecular weight of 177.25 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(3-methyl-7,7a-dihydro-1-benzofuran-2-yl)methanamine is sourced from PubChem (CID 143482378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).