About 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole
1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole (PubChem CID 143482506) has the molecular formula C13H13BrF3N
and a molecular weight of 320.15 g/mol. Its IUPAC name is 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole |
| PubChem CID | 143482506 |
| Molecular Formula | C13H13BrF3N |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole |
| SMILES | CC1=CCC(C)N1c1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13BrF3N/c1-8-3-4-9(2)18(8)12-6-10(13(15,16)17)5-11(14)7-12/h3,5-7,9H,4H2,1-2H3 |
| InChIKey | LVSDLNIEZLBREU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole?
The IUPAC name of 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole (CID 143482506) is 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole.
What is the SMILES notation for 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole?
The canonical SMILES for 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole is CC1=CCC(C)N1c1cc(Br)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole?
The InChIKey is LVSDLNIEZLBREU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrF3N/c1-8-3-4-9(2)18(8)12-6-10(13(15,16)17)5-11(14)7-12/h3,5-7,9H,4H2,1-2H3.
What are the key properties of 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole?
1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole has a molecular weight of 320.15 g/mol, XLogP of 4.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,5-dimethyl-2,3-dihydropyrrole is sourced from PubChem (CID 143482506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).