About (4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane
(4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane (PubChem CID 143482571) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane.
Molecular Properties
| Compound Name | (4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane |
| PubChem CID | 143482571 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane |
| SMILES | C/C=c1/cn[nH]/c1=C/C.CC |
| InChI | InChI=1S/C7H10N2.C2H6/c1-3-6-5-8-9-7(6)4-2;1-2/h3-5,9H,1-2H3;1-2H3/b6-3-,7-4+; |
| InChIKey | INPUTCIMVRWGIR-SMNOYOBLSA-N |
| XLogP | 1.04 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane?
The IUPAC name of (4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane (CID 143482571) is (4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane.
What is the SMILES notation for (4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane?
The canonical SMILES for (4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane is C/C=c1/cn[nH]/c1=C/C.CC.
What is the InChIKey of (4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane?
The InChIKey is INPUTCIMVRWGIR-SMNOYOBLSA-N. The full InChI is InChI=1S/C7H10N2.C2H6/c1-3-6-5-8-9-7(6)4-2;1-2/h3-5,9H,1-2H3;1-2H3/b6-3-,7-4+;.
What are the key properties of (4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane?
(4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane has a molecular weight of 152.24 g/mol, XLogP of 1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-4,5-di(ethylidene)-1H-pyrazole;ethane is sourced from PubChem (CID 143482571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).