C11H17N — CID 143482880
(3E,5Z,7E)-3,6-dimethylcyclonona-3,5,7-trien-1-amine (PubChem CID 143482880) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (3E,5Z,7E)-3,6-dimethylcyclonona-3,5,7-trien-1-amine.
| Compound Name | (3E,5Z,7E)-3,6-dimethylcyclonona-3,5,7-trien-1-amine |
|---|---|
| PubChem CID | 143482880 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (3E,5Z,7E)-3,6-dimethylcyclonona-3,5,7-trien-1-amine |
| SMILES | CC1=C/C=C(\C)CC(N)C\C=C\1 |
| InChI | InChI=1S/C11H17N/c1-9-4-3-5-11(12)8-10(2)7-6-9/h3-4,6-7,11H,5,8,12H2,1-2H3/b4-3+,9-6-,10-7+ |
| InChIKey | JYUJMNJYVKEDGP-MOENOOKKSA-N |
| XLogP | 2.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |