C26H31N7O2 — CID 143483013
tert-butyl 4-[4-[3-(4-methyl-1,5-dihydro-1,2,4-triazol-5-yl)anilino]-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 143483013) has the molecular formula C26H31N7O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is tert-butyl 4-[4-[3-(4-methyl-1,5-dihydro-1,2,4-triazol-5-yl)anilino]-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[3-(4-methyl-1,5-dihydro-1,2,4-triazol-5-yl)anilino]-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 143483013 |
| Molecular Formula | C26H31N7O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | tert-butyl 4-[4-[3-(4-methyl-1,5-dihydro-1,2,4-triazol-5-yl)anilino]-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CN1C=NNC1c1cccc(Nc2ccnc3[nH]c(C4=CCN(C(=O)OC(C)(C)C)CC4)cc23)c1 |
| InChI | InChI=1S/C26H31N7O2/c1-26(2,3)35-25(34)33-12-9-17(10-13-33)22-15-20-21(8-11-27-23(20)30-22)29-19-7-5-6-18(14-19)24-31-28-16-32(24)4/h5-9,11,14-16,24,31H,10,12-13H2,1-4H3,(H2,27,29,30) |
| InChIKey | MGTNIUYHRFGFEK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |