About 5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene
5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 143483015) has the molecular formula C12H19N3
and a molecular weight of 205.30 g/mol. Its IUPAC name is 5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene.
Molecular Properties
| Compound Name | 5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene |
| PubChem CID | 143483015 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | CC1=CC=NC2(N3CCN(C)CC3)CC12 |
| InChI | InChI=1S/C12H19N3/c1-10-3-4-13-12(9-11(10)12)15-7-5-14(2)6-8-15/h3-4,11H,5-9H2,1-2H3 |
| InChIKey | UZRNLEURRSRRAV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene?
The IUPAC name of 5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene (CID 143483015) is 5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene.
What is the SMILES notation for 5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene?
The canonical SMILES for 5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene is CC1=CC=NC2(N3CCN(C)CC3)CC12.
What is the InChIKey of 5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene?
The InChIKey is UZRNLEURRSRRAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3/c1-10-3-4-13-12(9-11(10)12)15-7-5-14(2)6-8-15/h3-4,11H,5-9H2,1-2H3.
What are the key properties of 5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene?
5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene has a molecular weight of 205.30 g/mol, XLogP of 0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-(4-methylpiperazin-1-yl)-2-azabicyclo[4.1.0]hepta-2,4-diene is sourced from PubChem (CID 143483015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).