C14H18OS — CID 143483405
4-ethyl-1-methoxy-2-[(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]benzene (PubChem CID 143483405) has the molecular formula C14H18OS and a molecular weight of 234.36 g/mol. Its IUPAC name is 4-ethyl-1-methoxy-2-[(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]benzene.
| Compound Name | 4-ethyl-1-methoxy-2-[(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]benzene |
|---|---|
| PubChem CID | 143483405 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 4-ethyl-1-methoxy-2-[(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]benzene |
| SMILES | C=C/C(=C\SC)c1cc(CC)ccc1OC |
| InChI | InChI=1S/C14H18OS/c1-5-11-7-8-14(15-3)13(9-11)12(6-2)10-16-4/h6-10H,2,5H2,1,3-4H3/b12-10+ |
| InChIKey | ITBKFYLHSOVAGX-ZRDIBKRKSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|