C31H35N3O2 — CID 143483617
4-ethylphenol;formamide;5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2,3-diphenyl-3,4-dihydropyrazole (PubChem CID 143483617) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 4-ethylphenol;formamide;5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2,3-diphenyl-3,4-dihydropyrazole.
| Compound Name | 4-ethylphenol;formamide;5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2,3-diphenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 143483617 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 4-ethylphenol;formamide;5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2,3-diphenyl-3,4-dihydropyrazole |
| SMILES | C=C/C=C\C=C(/C)C1=NN(c2ccccc2)C(c2ccccc2)C1.CCc1ccc(O)cc1.NC=O |
| InChI | InChI=1S/C22H22N2.C8H10O.CH3NO/c1-3-4-7-12-18(2)21-17-22(19-13-8-5-9-14-19)24(23-21)20-15-10-6-11-16-20;1-2-7-3-5-8(9)6-4-7;2-1-3/h3-16,22H,1,17H2,2H3;3-6,9H,2H2,1H3;1H,(H2,2,3)/b7-4-,18-12+;; |
| InChIKey | ZWUDQJITKFFNRB-JFMXADFQSA-N |
| XLogP | 6.74 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|