C28H27F3N6O2 — CID 143483876
N-cyclohexyl-3-[hydroxy-[[5-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]amino]methyl]benzamide (PubChem CID 143483876) has the molecular formula C28H27F3N6O2 and a molecular weight of 536.56 g/mol. Its IUPAC name is N-cyclohexyl-3-[hydroxy-[[5-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]amino]methyl]benzamide.
| Compound Name | N-cyclohexyl-3-[hydroxy-[[5-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 143483876 |
| Molecular Formula | C28H27F3N6O2 |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | N-cyclohexyl-3-[hydroxy-[[5-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]amino]methyl]benzamide |
| SMILES | O=C(NC1CCCCC1)c1cccc(C(O)Nc2ccc(-n3nc(-c4cccnc4)cc3C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C28H27F3N6O2/c29-28(30,31)24-15-23(20-8-5-13-32-16-20)36-37(24)22-11-12-25(33-17-22)35-27(39)19-7-4-6-18(14-19)26(38)34-21-9-2-1-3-10-21/h4-8,11-17,21,27,39H,1-3,9-10H2,(H,33,35)(H,34,38) |
| InChIKey | XLLOTFWXKXDONJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|