C19H32N2O3 — CID 143483997
1-[(2E,4E,6Z)-1-(dimethylamino)-2-methyl-1-oxoocta-2,4,6-trien-4-yl]piperidine-3-carboxylic acid;ethane (PubChem CID 143483997) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-[(2E,4E,6Z)-1-(dimethylamino)-2-methyl-1-oxoocta-2,4,6-trien-4-yl]piperidine-3-carboxylic acid;ethane.
| Compound Name | 1-[(2E,4E,6Z)-1-(dimethylamino)-2-methyl-1-oxoocta-2,4,6-trien-4-yl]piperidine-3-carboxylic acid;ethane |
|---|---|
| PubChem CID | 143483997 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | 1-[(2E,4E,6Z)-1-(dimethylamino)-2-methyl-1-oxoocta-2,4,6-trien-4-yl]piperidine-3-carboxylic acid;ethane |
| SMILES | C/C=C\C=C(/C=C(\C)C(=O)N(C)C)N1CCCC(C(=O)O)C1.CC |
| InChI | InChI=1S/C17H26N2O3.C2H6/c1-5-6-9-15(11-13(2)16(20)18(3)4)19-10-7-8-14(12-19)17(21)22;1-2/h5-6,9,11,14H,7-8,10,12H2,1-4H3,(H,21,22);1-2H3/b6-5-,13-11+,15-9+; |
| InChIKey | XLIVCYOSIHXYLZ-PNGMPULXSA-N |
| XLogP | 3.30 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|