C14H13N3O2S — CID 143484238
1-N-(pyridin-2-ylmethyl)-3-N-sulfanylbenzene-1,3-dicarboxamide (PubChem CID 143484238) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-N-(pyridin-2-ylmethyl)-3-N-sulfanylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-(pyridin-2-ylmethyl)-3-N-sulfanylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 143484238 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-N-(pyridin-2-ylmethyl)-3-N-sulfanylbenzene-1,3-dicarboxamide |
| SMILES | O=C(NS)c1cccc(C(=O)NCc2ccccn2)c1 |
| InChI | InChI=1S/C14H13N3O2S/c18-13(16-9-12-6-1-2-7-15-12)10-4-3-5-11(8-10)14(19)17-20/h1-8,20H,9H2,(H,16,18)(H,17,19) |
| InChIKey | MFSTZWGROZORKQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|