C31H33F3N6O2 — CID 143484799
ethane;6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]oxy-N-[6-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]pyridine-3-carboxamide (PubChem CID 143484799) has the molecular formula C31H33F3N6O2 and a molecular weight of 578.64 g/mol. Its IUPAC name is ethane;6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]oxy-N-[6-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]pyridine-3-carboxamide.
| Compound Name | ethane;6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]oxy-N-[6-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 143484799 |
| Molecular Formula | C31H33F3N6O2 |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | ethane;6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]oxy-N-[6-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]pyridine-3-carboxamide |
| SMILES | C=C(/C=C\C=C/C)Oc1ccc(C(=O)Nc2ccc(-n3nc(-c4cccnc4)cc3C(F)(F)F)nc2)cn1.CC.CC |
| InChI | InChI=1S/C27H21F3N6O2.2C2H6/c1-3-4-5-7-18(2)38-25-12-9-20(16-33-25)26(37)34-21-10-11-24(32-17-21)36-23(27(28,29)30)14-22(35-36)19-8-6-13-31-15-19;2*1-2/h3-17H,2H2,1H3,(H,34,37);2*1-2H3/b4-3-,7-5-;; |
| InChIKey | BCAQPQFOZAOIJG-XSQCETJGSA-N |
| XLogP | 8.07 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|