C13H11Cl3N6S — CID 143484843
5-chloro-3-N-(3,4-dichlorophenyl)sulfanyl-2-N-(2,3-dihydro-1H-1,2,4-triazol-5-yl)pyridine-2,3-diamine (PubChem CID 143484843) has the molecular formula C13H11Cl3N6S and a molecular weight of 389.70 g/mol. Its IUPAC name is 5-chloro-3-N-(3,4-dichlorophenyl)sulfanyl-2-N-(2,3-dihydro-1H-1,2,4-triazol-5-yl)pyridine-2,3-diamine.
| Compound Name | 5-chloro-3-N-(3,4-dichlorophenyl)sulfanyl-2-N-(2,3-dihydro-1H-1,2,4-triazol-5-yl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 143484843 |
| Molecular Formula | C13H11Cl3N6S |
| Molecular Weight | 389.70 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 5-chloro-3-N-(3,4-dichlorophenyl)sulfanyl-2-N-(2,3-dihydro-1H-1,2,4-triazol-5-yl)pyridine-2,3-diamine |
| SMILES | Clc1cnc(NC2=NCNN2)c(NSc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C13H11Cl3N6S/c14-7-3-11(12(17-5-7)20-13-18-6-19-21-13)22-23-8-1-2-9(15)10(16)4-8/h1-5,19,22H,6H2,(H2,17,18,20,21) |
| InChIKey | RNARVLXLOCYYMJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 73.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.70 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|