About 1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone
1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone (PubChem CID 143484925) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone |
| PubChem CID | 143484925 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone |
| SMILES | C=CC1=C(C=C)N(C(C)=O)CC1 |
| InChI | InChI=1S/C10H13NO/c1-4-9-6-7-11(8(3)12)10(9)5-2/h4-5H,1-2,6-7H2,3H3 |
| InChIKey | SDDDSKRZMWNYLW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone?
The IUPAC name of 1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone (CID 143484925) is 1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone.
What is the SMILES notation for 1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone?
The canonical SMILES for 1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone is C=CC1=C(C=C)N(C(C)=O)CC1.
What is the InChIKey of 1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone?
The InChIKey is SDDDSKRZMWNYLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-4-9-6-7-11(8(3)12)10(9)5-2/h4-5H,1-2,6-7H2,3H3.
What are the key properties of 1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone?
1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone has a molecular weight of 163.22 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4,5-bis(ethenyl)-2,3-dihydropyrrol-1-yl]ethanone is sourced from PubChem (CID 143484925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).