C39H66N2O2 — CID 143485706
3-[(4-tert-butyl-2,3,6-trimethylphenyl)methyl]-3-ethyl-1,5-bis(2,2,6,6-tetramethylpiperidin-4-yl)pentane-2,4-dione (PubChem CID 143485706) has the molecular formula C39H66N2O2 and a molecular weight of 594.97 g/mol. Its IUPAC name is 3-[(4-tert-butyl-2,3,6-trimethylphenyl)methyl]-3-ethyl-1,5-bis(2,2,6,6-tetramethylpiperidin-4-yl)pentane-2,4-dione.
| Compound Name | 3-[(4-tert-butyl-2,3,6-trimethylphenyl)methyl]-3-ethyl-1,5-bis(2,2,6,6-tetramethylpiperidin-4-yl)pentane-2,4-dione |
|---|---|
| PubChem CID | 143485706 |
| Molecular Formula | C39H66N2O2 |
| Molecular Weight | 594.97 g/mol |
| Exact Mass | 594.51 |
| IUPAC Name | 3-[(4-tert-butyl-2,3,6-trimethylphenyl)methyl]-3-ethyl-1,5-bis(2,2,6,6-tetramethylpiperidin-4-yl)pentane-2,4-dione |
| SMILES | CCC(Cc1c(C)cc(C(C)(C)C)c(C)c1C)(C(=O)CC1CC(C)(C)NC(C)(C)C1)C(=O)CC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C39H66N2O2/c1-16-39(32(42)18-28-20-35(8,9)40-36(10,11)21-28,33(43)19-29-22-37(12,13)41-38(14,15)23-29)24-30-25(2)17-31(34(5,6)7)27(4)26(30)3/h17,28-29,40-41H,16,18-24H2,1-15H3 |
| InChIKey | YGVKZIWXCBRRFO-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.97 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|