C41H70N2O — CID 143485720
3-[(3,5-ditert-butylphenyl)methyl]-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]pent-4-en-2-one (PubChem CID 143485720) has the molecular formula C41H70N2O and a molecular weight of 607.02 g/mol. Its IUPAC name is 3-[(3,5-ditert-butylphenyl)methyl]-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]pent-4-en-2-one.
| Compound Name | 3-[(3,5-ditert-butylphenyl)methyl]-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]pent-4-en-2-one |
|---|---|
| PubChem CID | 143485720 |
| Molecular Formula | C41H70N2O |
| Molecular Weight | 607.02 g/mol |
| Exact Mass | 606.55 |
| IUPAC Name | 3-[(3,5-ditert-butylphenyl)methyl]-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]pent-4-en-2-one |
| SMILES | C=C(CC1CC(C)(C)N(C)C(C)(C)C1)C(Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1)C(=O)CC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C41H70N2O/c1-28(18-30-24-38(8,9)42(16)39(10,11)25-30)34(35(44)22-31-26-40(12,13)43(17)41(14,15)27-31)21-29-19-32(36(2,3)4)23-33(20-29)37(5,6)7/h19-20,23,30-31,34H,1,18,21-22,24-27H2,2-17H3 |
| InChIKey | VXTXWEXGMPPOGZ-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.02 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|