C44H76N2O3 — CID 143485730
(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 2-[(3-tert-butyl-5-methylphenyl)methyl]-2-[2-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)acetyl]hexanoate (PubChem CID 143485730) has the molecular formula C44H76N2O3 and a molecular weight of 681.10 g/mol. Its IUPAC name is (2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 2-[(3-tert-butyl-5-methylphenyl)methyl]-2-[2-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)acetyl]hexanoate.
| Compound Name | (2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 2-[(3-tert-butyl-5-methylphenyl)methyl]-2-[2-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)acetyl]hexanoate |
|---|---|
| PubChem CID | 143485730 |
| Molecular Formula | C44H76N2O3 |
| Molecular Weight | 681.10 g/mol |
| Exact Mass | 680.59 |
| IUPAC Name | (2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 2-[(3-tert-butyl-5-methylphenyl)methyl]-2-[2-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)acetyl]hexanoate |
| SMILES | CCCCC(Cc1cc(C)cc(C(C)(C)C)c1)(C(=O)CC1CC(C)(CC)NC(C)(CC)C1C)C(=O)OC1CC(C)(CC)NC(C)(CC)C1C |
| InChI | InChI=1S/C44H76N2O3/c1-16-21-22-44(27-33-23-30(6)24-35(25-33)39(9,10)11,37(47)26-34-28-40(12,17-2)45-42(14,19-4)31(34)7)38(48)49-36-29-41(13,18-3)46-43(15,20-5)32(36)8/h23-25,31-32,34,36,45-46H,16-22,26-29H2,1-15H3 |
| InChIKey | BSCOCEUTTLORHO-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.10 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|