C24H13F13S — CID 143485863
1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3-methylsulfanylpentan-3-yl)phenyl]phenyl]benzene (PubChem CID 143485863) has the molecular formula C24H13F13S and a molecular weight of 580.41 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3-methylsulfanylpentan-3-yl)phenyl]phenyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3-methylsulfanylpentan-3-yl)phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 143485863 |
| Molecular Formula | C24H13F13S |
| Molecular Weight | 580.41 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3-methylsulfanylpentan-3-yl)phenyl]phenyl]benzene |
| SMILES | CCC(CC)(SC)c1c(F)c(F)c(-c2c(F)c(F)c(-c3c(F)c(F)c(F)c(F)c3F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24H13F13S/c1-4-24(5-2,38-3)10-19(33)15(29)8(16(30)20(10)34)6-11(25)13(27)7(14(28)12(6)26)9-17(31)21(35)23(37)22(36)18(9)32/h4-5H2,1-3H3 |
| InChIKey | HATJPCXXEVCFCN-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.41 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|