About 3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine
3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine (PubChem CID 143486039) has the molecular formula C13H28N2O2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine.
Molecular Properties
| Compound Name | 3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine |
| PubChem CID | 143486039 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine |
| SMILES | CCOC1CNCC1CC.COC1CCNC1 |
| InChI | InChI=1S/C8H17NO.C5H11NO/c1-3-7-5-9-6-8(7)10-4-2;1-7-5-2-3-6-4-5/h7-9H,3-6H2,1-2H3;5-6H,2-4H2,1H3 |
| InChIKey | DTLBBZOAZHFDSZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine?
The IUPAC name of 3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine (CID 143486039) is 3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine.
What is the SMILES notation for 3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine?
The canonical SMILES for 3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine is CCOC1CNCC1CC.COC1CCNC1.
What is the InChIKey of 3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine?
The InChIKey is DTLBBZOAZHFDSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.C5H11NO/c1-3-7-5-9-6-8(7)10-4-2;1-7-5-2-3-6-4-5/h7-9H,3-6H2,1-2H3;5-6H,2-4H2,1H3.
What are the key properties of 3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine?
3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine has a molecular weight of 244.38 g/mol, XLogP of 1.02, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-4-ethylpyrrolidine;3-methoxypyrrolidine is sourced from PubChem (CID 143486039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).