About 4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid
4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid (PubChem CID 143486126) has the molecular formula C16H29N3O3
and a molecular weight of 311.43 g/mol. Its IUPAC name is 4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid |
| PubChem CID | 143486126 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(OC[C@@H]2C[C@H](N3CCNCC3)CN2)CC1 |
| InChI | InChI=1S/C16H29N3O3/c20-16(21)12-1-3-15(4-2-12)22-11-13-9-14(10-18-13)19-7-5-17-6-8-19/h12-15,17-18H,1-11H2,(H,20,21)/t12?,13-,14-,15?/m0/s1 |
| InChIKey | LXFKEBKJFQHXIH-GQKFXUNGSA-N |
| XLogP | 0.28 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid?
The IUPAC name of 4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid (CID 143486126) is 4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid is O=C(O)C1CCC(OC[C@@H]2C[C@H](N3CCNCC3)CN2)CC1.
What is the InChIKey of 4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid?
The InChIKey is LXFKEBKJFQHXIH-GQKFXUNGSA-N. The full InChI is InChI=1S/C16H29N3O3/c20-16(21)12-1-3-15(4-2-12)22-11-13-9-14(10-18-13)19-7-5-17-6-8-19/h12-15,17-18H,1-11H2,(H,20,21)/t12?,13-,14-,15?/m0/s1.
What are the key properties of 4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid?
4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid has a molecular weight of 311.43 g/mol, XLogP of 0.28, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2S,4S)-4-piperazin-1-ylpyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 143486126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).