C6H10F6N2O — CID 143486825
2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxyethylhydrazine (PubChem CID 143486825) has the molecular formula C6H10F6N2O and a molecular weight of 240.15 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxyethylhydrazine.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxyethylhydrazine |
|---|---|
| PubChem CID | 143486825 |
| Molecular Formula | C6H10F6N2O |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxyethylhydrazine |
| SMILES | CC(OCCNN)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H10F6N2O/c1-4(5(7,8)9,6(10,11)12)15-3-2-14-13/h14H,2-3,13H2,1H3 |
| InChIKey | XJMRWCNOXVRUOA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|