About ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine
ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine (PubChem CID 143487003) has the molecular formula C16H35N3O
and a molecular weight of 285.48 g/mol. Its IUPAC name is ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine.
Molecular Properties
| Compound Name | ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine |
| PubChem CID | 143487003 |
| Molecular Formula | C16H35N3O |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.28 |
| IUPAC Name | ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine |
| SMILES | C=C(NCC(N)C[C@H]1CCCCOC1)N(C)CC.CC |
| InChI | InChI=1S/C14H29N3O.C2H6/c1-4-17(3)12(2)16-10-14(15)9-13-7-5-6-8-18-11-13;1-2/h13-14,16H,2,4-11,15H2,1,3H3;1-2H3/t13-,14?;/m1./s1 |
| InChIKey | QOOPSQXTGURQIS-JRLNIEDVSA-N |
| XLogP | 2.56 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine?
The IUPAC name of ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine (CID 143487003) is ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine.
What is the SMILES notation for ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine?
The canonical SMILES for ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine is C=C(NCC(N)C[C@H]1CCCCOC1)N(C)CC.CC.
What is the InChIKey of ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine?
The InChIKey is QOOPSQXTGURQIS-JRLNIEDVSA-N. The full InChI is InChI=1S/C14H29N3O.C2H6/c1-4-17(3)12(2)16-10-14(15)9-13-7-5-6-8-18-11-13;1-2/h13-14,16H,2,4-11,15H2,1,3H3;1-2H3/t13-,14?;/m1./s1.
What are the key properties of ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine?
ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine has a molecular weight of 285.48 g/mol, XLogP of 2.56, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-N-[1-[ethyl(methyl)amino]ethenyl]-3-[(3R)-oxepan-3-yl]propane-1,2-diamine is sourced from PubChem (CID 143487003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).