C20H23N5O5 — CID 14348704
(2R,3R,4S,5R)-2-[6-[(1-hydroxy-2,3-dihydroinden-1-yl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 14348704) has the molecular formula C20H23N5O5 and a molecular weight of 413.43 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[(1-hydroxy-2,3-dihydroinden-1-yl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[(1-hydroxy-2,3-dihydroinden-1-yl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 14348704 |
| Molecular Formula | C20H23N5O5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[(1-hydroxy-2,3-dihydroinden-1-yl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NCC4(O)CCc5ccccc54)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H23N5O5/c26-7-13-15(27)16(28)19(30-13)25-10-24-14-17(22-9-23-18(14)25)21-8-20(29)6-5-11-3-1-2-4-12(11)20/h1-4,9-10,13,15-16,19,26-29H,5-8H2,(H,21,22,23)/t13-,15-,16-,19-,20?/m1/s1 |
| InChIKey | GCUDUXZVTHJHDZ-DBGWDLSPSA-N |
| XLogP | -0.32 |
| TPSA | 145.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |