C13H25NO4 — CID 143487068
[(2R)-1-hydroxy-3-[(3R)-oxan-3-yl]propan-2-yl] N-tert-butylcarbamate (PubChem CID 143487068) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is [(2R)-1-hydroxy-3-[(3R)-oxan-3-yl]propan-2-yl] N-tert-butylcarbamate.
| Compound Name | [(2R)-1-hydroxy-3-[(3R)-oxan-3-yl]propan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 143487068 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | [(2R)-1-hydroxy-3-[(3R)-oxan-3-yl]propan-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@@H](CO)C[C@H]1CCCOC1 |
| InChI | InChI=1S/C13H25NO4/c1-13(2,3)14-12(16)18-11(8-15)7-10-5-4-6-17-9-10/h10-11,15H,4-9H2,1-3H3,(H,14,16)/t10-,11-/m1/s1 |
| InChIKey | WOCAGMJKKRCDBH-GHMZBOCLSA-N |
| XLogP | 1.69 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |