C8H10BrCl — CID 143487102
(3Z,5E)-5-bromo-7-chloro-4-methylhepta-1,3,5-triene (PubChem CID 143487102) has the molecular formula C8H10BrCl and a molecular weight of 221.52 g/mol. Its IUPAC name is (3Z,5E)-5-bromo-7-chloro-4-methylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-5-bromo-7-chloro-4-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143487102 |
| Molecular Formula | C8H10BrCl |
| Molecular Weight | 221.52 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | (3Z,5E)-5-bromo-7-chloro-4-methylhepta-1,3,5-triene |
| SMILES | C=C/C=C(C)\C(Br)=C/CCl |
| InChI | InChI=1S/C8H10BrCl/c1-3-4-7(2)8(9)5-6-10/h3-5H,1,6H2,2H3/b7-4-,8-5+ |
| InChIKey | BXBDRUGXLDVVLS-DKBJKEKUSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|