C19H23FN4O2S — CID 143487336
N'-[4-(dimethylamino)-2-formylthieno[2,3-b]pyridin-3-yl]-N-(3-fluoro-4-hydroxycyclohexa-1,5-dien-1-yl)methanimidamide;ethane (PubChem CID 143487336) has the molecular formula C19H23FN4O2S and a molecular weight of 390.48 g/mol. Its IUPAC name is N'-[4-(dimethylamino)-2-formylthieno[2,3-b]pyridin-3-yl]-N-(3-fluoro-4-hydroxycyclohexa-1,5-dien-1-yl)methanimidamide;ethane.
| Compound Name | N'-[4-(dimethylamino)-2-formylthieno[2,3-b]pyridin-3-yl]-N-(3-fluoro-4-hydroxycyclohexa-1,5-dien-1-yl)methanimidamide;ethane |
|---|---|
| PubChem CID | 143487336 |
| Molecular Formula | C19H23FN4O2S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N'-[4-(dimethylamino)-2-formylthieno[2,3-b]pyridin-3-yl]-N-(3-fluoro-4-hydroxycyclohexa-1,5-dien-1-yl)methanimidamide;ethane |
| SMILES | CC.CN(C)c1ccnc2sc(C=O)c(/N=C/NC3=CC(F)C(O)C=C3)c12 |
| InChI | InChI=1S/C17H17FN4O2S.C2H6/c1-22(2)12-5-6-19-17-15(12)16(14(8-23)25-17)21-9-20-10-3-4-13(24)11(18)7-10;1-2/h3-9,11,13,24H,1-2H3,(H,20,21);1-2H3 |
| InChIKey | LAGIXXSTYTVOCV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|