C20H22N4OS — CID 143487424
5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-13-(propylamino)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 143487424) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-13-(propylamino)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-13-(propylamino)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 143487424 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-13-(propylamino)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | C=C/C(C)=C\C=C(/C)n1cnc2c(sc3nccc(NCCC)c32)c1=O |
| InChI | InChI=1S/C20H22N4OS/c1-5-10-21-15-9-11-22-19-16(15)17-18(26-19)20(25)24(12-23-17)14(4)8-7-13(3)6-2/h6-9,11-12H,2,5,10H2,1,3-4H3,(H,21,22)/b13-7-,14-8+ |
| InChIKey | PPJOEZYPKVILIT-MFUUIURDSA-N |
| XLogP | 4.82 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|