C22H27FN4OS — CID 143488116
10-(ethylamino)-3-[(2E,4E,6Z)-5-fluoroocta-2,4,6-trien-2-yl]-6,9,11-trimethylpyrimido[4,5-h][1,3]thiazonin-4-one (PubChem CID 143488116) has the molecular formula C22H27FN4OS and a molecular weight of 414.55 g/mol. Its IUPAC name is 10-(ethylamino)-3-[(2E,4E,6Z)-5-fluoroocta-2,4,6-trien-2-yl]-6,9,11-trimethylpyrimido[4,5-h][1,3]thiazonin-4-one.
| Compound Name | 10-(ethylamino)-3-[(2E,4E,6Z)-5-fluoroocta-2,4,6-trien-2-yl]-6,9,11-trimethylpyrimido[4,5-h][1,3]thiazonin-4-one |
|---|---|
| PubChem CID | 143488116 |
| Molecular Formula | C22H27FN4OS |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 10-(ethylamino)-3-[(2E,4E,6Z)-5-fluoroocta-2,4,6-trien-2-yl]-6,9,11-trimethylpyrimido[4,5-h][1,3]thiazonin-4-one |
| SMILES | C/C=C\C(F)=C/C=C(\C)n1cnc2c(C)c(NCC)c(C)cnc(C)sc2c1=O |
| InChI | InChI=1S/C22H27FN4OS/c1-7-9-18(23)11-10-15(4)27-13-26-20-16(5)19(24-8-2)14(3)12-25-17(6)29-21(20)22(27)28/h7,9-13,24H,8H2,1-6H3/b9-7-,14-12-,15-10+,18-11+,19-16+,25-17- |
| InChIKey | PYAKJDABBYPMNF-KAZDYPOMSA-N |
| XLogP | 5.62 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|