C19H21N5O — CID 143488147
8-methyl-13-(methylamino)-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 143488147) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 8-methyl-13-(methylamino)-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 8-methyl-13-(methylamino)-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 143488147 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 8-methyl-13-(methylamino)-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | C=C/C(C)=C\C=C(/C)n1cnc2c3c(NC)ccnc3n(C)c2c1=O |
| InChI | InChI=1S/C19H21N5O/c1-6-12(2)7-8-13(3)24-11-22-16-15-14(20-4)9-10-21-18(15)23(5)17(16)19(24)25/h6-11H,1H2,2-5H3,(H,20,21)/b12-7-,13-8+ |
| InChIKey | DUABZWYKPGTHKS-HAKHBUOSSA-N |
| XLogP | 3.32 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|