C18H23N5O2S — CID 143488221
13-(ethynylamino)-5-(4-methoxycyclohexyl)-11-methyl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-trien-6-one (PubChem CID 143488221) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 13-(ethynylamino)-5-(4-methoxycyclohexyl)-11-methyl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-trien-6-one.
| Compound Name | 13-(ethynylamino)-5-(4-methoxycyclohexyl)-11-methyl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-trien-6-one |
|---|---|
| PubChem CID | 143488221 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 13-(ethynylamino)-5-(4-methoxycyclohexyl)-11-methyl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-trien-6-one |
| SMILES | C#CNC1NC(C)Nc2sc3c(=O)n(C4CCC(OC)CC4)cnc3c21 |
| InChI | InChI=1S/C18H23N5O2S/c1-4-19-16-13-14-15(26-17(13)22-10(2)21-16)18(24)23(9-20-14)11-5-7-12(25-3)8-6-11/h1,9-12,16,19,21-22H,5-8H2,2-3H3 |
| InChIKey | IUQWQCNGZHDBSL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|