About hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate
hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate (PubChem CID 143488487) has the molecular formula C15H24N2O3
and a molecular weight of 280.37 g/mol. Its IUPAC name is hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate |
| PubChem CID | 143488487 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate |
| SMILES | CCC1(C(=O)OC)CCN(Cc2ccccc2)C1.NO |
| InChI | InChI=1S/C15H21NO2.H3NO/c1-3-15(14(17)18-2)9-10-16(12-15)11-13-7-5-4-6-8-13;1-2/h4-8H,3,9-12H2,1-2H3;2H,1H2 |
| InChIKey | OIZFGSJNHUQQRO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate?
The IUPAC name of hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate (CID 143488487) is hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate.
What is the SMILES notation for hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate?
The canonical SMILES for hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate is CCC1(C(=O)OC)CCN(Cc2ccccc2)C1.NO.
What is the InChIKey of hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate?
The InChIKey is OIZFGSJNHUQQRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2.H3NO/c1-3-15(14(17)18-2)9-10-16(12-15)11-13-7-5-4-6-8-13;1-2/h4-8H,3,9-12H2,1-2H3;2H,1H2.
What are the key properties of hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate?
hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate has a molecular weight of 280.37 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxylamine;methyl 1-benzyl-3-ethylpyrrolidine-3-carboxylate is sourced from PubChem (CID 143488487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).