About 1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol
1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol (PubChem CID 143488995) has the molecular formula C15H26N2O2S
and a molecular weight of 298.45 g/mol. Its IUPAC name is 1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol.
Molecular Properties
| Compound Name | 1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol |
| PubChem CID | 143488995 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol |
| SMILES | CC(C)(C)c1ccc(SO)cc1.OCC1CNCCN1 |
| InChI | InChI=1S/C10H14OS.C5H12N2O/c1-10(2,3)8-4-6-9(12-11)7-5-8;8-4-5-3-6-1-2-7-5/h4-7,11H,1-3H3;5-8H,1-4H2 |
| InChIKey | KBEWRWJEYTZAJW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol?
The IUPAC name of 1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol (CID 143488995) is 1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol.
What is the SMILES notation for 1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol?
The canonical SMILES for 1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol is CC(C)(C)c1ccc(SO)cc1.OCC1CNCCN1.
What is the InChIKey of 1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol?
The InChIKey is KBEWRWJEYTZAJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14OS.C5H12N2O/c1-10(2,3)8-4-6-9(12-11)7-5-8;8-4-5-3-6-1-2-7-5/h4-7,11H,1-3H3;5-8H,1-4H2.
What are the key properties of 1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol?
1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol has a molecular weight of 298.45 g/mol, XLogP of 2.09, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-hydroxysulfanylbenzene;piperazin-2-ylmethanol is sourced from PubChem (CID 143488995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).