About (4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile
(4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile (PubChem CID 143489045) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is (4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile.
Molecular Properties
| Compound Name | (4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile |
| PubChem CID | 143489045 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile |
| SMILES | C=C/C(=C\C(=C/C)C(C)CC#N)OC |
| InChI | InChI=1S/C12H17NO/c1-5-11(10(3)7-8-13)9-12(6-2)14-4/h5-6,9-10H,2,7H2,1,3-4H3/b11-5+,12-9+ |
| InChIKey | NTHSYQZZUICFER-HQOQYNLBSA-N |
| XLogP | 3.20 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile?
The IUPAC name of (4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile (CID 143489045) is (4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile.
What is the SMILES notation for (4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile?
The canonical SMILES for (4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile is C=C/C(=C\C(=C/C)C(C)CC#N)OC.
What is the InChIKey of (4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile?
The InChIKey is NTHSYQZZUICFER-HQOQYNLBSA-N. The full InChI is InChI=1S/C12H17NO/c1-5-11(10(3)7-8-13)9-12(6-2)14-4/h5-6,9-10H,2,7H2,1,3-4H3/b11-5+,12-9+.
What are the key properties of (4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile?
(4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile has a molecular weight of 191.27 g/mol, XLogP of 3.20, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,5E)-4-ethylidene-6-methoxy-3-methylocta-5,7-dienenitrile is sourced from PubChem (CID 143489045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).