About (2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine
(2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine (PubChem CID 143489412) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is (2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine.
Molecular Properties
| Compound Name | (2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine |
| PubChem CID | 143489412 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine |
| SMILES | C=C/C=C(\C=C)[C@H]1CNCCO1 |
| InChI | InChI=1S/C10H15NO/c1-3-5-9(4-2)10-8-11-6-7-12-10/h3-5,10-11H,1-2,6-8H2/b9-5+/t10-/m1/s1 |
| InChIKey | VSSFHXIAMOKMNB-NAZIUFLLSA-N |
| XLogP | 1.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine?
The IUPAC name of (2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine (CID 143489412) is (2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine.
What is the SMILES notation for (2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine?
The canonical SMILES for (2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine is C=C/C=C(\C=C)[C@H]1CNCCO1.
What is the InChIKey of (2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine?
The InChIKey is VSSFHXIAMOKMNB-NAZIUFLLSA-N. The full InChI is InChI=1S/C10H15NO/c1-3-5-9(4-2)10-8-11-6-7-12-10/h3-5,10-11H,1-2,6-8H2/b9-5+/t10-/m1/s1.
What are the key properties of (2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine?
(2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine has a molecular weight of 165.24 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(3E)-hexa-1,3,5-trien-3-yl]morpholine is sourced from PubChem (CID 143489412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).