C18H28N2O4 — CID 143489448
ethane-1,2-diol;methyl (3E)-7,7-dimethyl-2,5,6,8-tetrahydro-1H-1,5-benzodiazecine-3-carboxylate (PubChem CID 143489448) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is ethane-1,2-diol;methyl (3E)-7,7-dimethyl-2,5,6,8-tetrahydro-1H-1,5-benzodiazecine-3-carboxylate.
| Compound Name | ethane-1,2-diol;methyl (3E)-7,7-dimethyl-2,5,6,8-tetrahydro-1H-1,5-benzodiazecine-3-carboxylate |
|---|---|
| PubChem CID | 143489448 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | ethane-1,2-diol;methyl (3E)-7,7-dimethyl-2,5,6,8-tetrahydro-1H-1,5-benzodiazecine-3-carboxylate |
| SMILES | COC(=O)/C1=C/NCC(C)(C)Cc2ccccc2NC1.OCCO |
| InChI | InChI=1S/C16H22N2O2.C2H6O2/c1-16(2)8-12-6-4-5-7-14(12)18-10-13(9-17-11-16)15(19)20-3;3-1-2-4/h4-7,9,17-18H,8,10-11H2,1-3H3;3-4H,1-2H2/b13-9+; |
| InChIKey | RKLCXFWDGPEJGH-KJEVSKRMSA-N |
| XLogP | 1.30 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |