C12H18N2O — CID 143489606
methanamine;2,4,5,6-tetrahydro-1H-2-benzazocin-3-one (PubChem CID 143489606) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is methanamine;2,4,5,6-tetrahydro-1H-2-benzazocin-3-one.
| Compound Name | methanamine;2,4,5,6-tetrahydro-1H-2-benzazocin-3-one |
|---|---|
| PubChem CID | 143489606 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | methanamine;2,4,5,6-tetrahydro-1H-2-benzazocin-3-one |
| SMILES | CN.O=C1CCCc2ccccc2CN1 |
| InChI | InChI=1S/C11H13NO.CH5N/c13-11-7-3-6-9-4-1-2-5-10(9)8-12-11;1-2/h1-2,4-5H,3,6-8H2,(H,12,13);2H2,1H3 |
| InChIKey | FVBRJYLCPBKCSK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |